| Name | 5-Bromo-2-iodobenzoic acid |
| Synonyms | NSC 190696 RARECHEM AL BO 0892 5-bromo-2-iodobenzoate 2-iodo-5-bromobenzoic acid 5-BroMo-2-iodobenzoic acid 5-Bromo-2-iodobenzoic acid 5-BROMO-2-IODOBENZOIC ACID Benzoic acid, 5-broMo-2-iodo- |
| CAS | 21740-00-1 |
| EINECS | 675-666-4 |
| InChI | InChI=1/C7H4BrIO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11)/p-1 |
| Molecular Formula | C7H4BrIO2 |
| Molar Mass | 326.91 |
| Density | 2.331±0.06 g/cm3(Predicted) |
| Melting Point | 161-163°C |
| Boling Point | 133-134 °C(Press: 1 Torr) |
| Flash Point | 171.6°C |
| Water Solubility | Slightly soluble in water. |
| Solubility | soluble in Methanol |
| Vapor Presure | 8.17E-06mmHg at 25°C |
| Appearance | Solid |
| Color | White to Light yellow |
| pKa | 2.47±0.10(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Sensitive | Light Sensitive |
| MDL | MFCD00144771 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Hazard Class | IRRITANT |